C13H16N2O4 — CID 103578140
4,5-dimethoxy-2-nitro-N-pent-1-yn-3-ylaniline (PubChem CID 103578140) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-pent-1-yn-3-ylaniline.
| Compound Name | 4,5-dimethoxy-2-nitro-N-pent-1-yn-3-ylaniline |
|---|---|
| PubChem CID | 103578140 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-pent-1-yn-3-ylaniline |
| SMILES | C#CC(CC)Nc1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O4/c1-5-9(6-2)14-10-7-12(18-3)13(19-4)8-11(10)15(16)17/h1,7-9,14H,6H2,2-4H3 |
| InChIKey | LLQPOVYVMSIBQG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|