C12H13N3O3 — CID 106231324
3-nitro-4-(pent-1-yn-3-ylamino)benzamide (PubChem CID 106231324) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 3-nitro-4-(pent-1-yn-3-ylamino)benzamide.
| Compound Name | 3-nitro-4-(pent-1-yn-3-ylamino)benzamide |
|---|---|
| PubChem CID | 106231324 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 3-nitro-4-(pent-1-yn-3-ylamino)benzamide |
| SMILES | C#CC(CC)Nc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O3/c1-3-9(4-2)14-10-6-5-8(12(13)16)7-11(10)15(17)18/h1,5-7,9,14H,4H2,2H3,(H2,13,16) |
| InChIKey | RNDDVDJHBMSDFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|