C11H12F3N3O3 — CID 104854539
3-nitro-4-(4,4,4-trifluorobutan-2-ylamino)benzamide (PubChem CID 104854539) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 3-nitro-4-(4,4,4-trifluorobutan-2-ylamino)benzamide.
| Compound Name | 3-nitro-4-(4,4,4-trifluorobutan-2-ylamino)benzamide |
|---|---|
| PubChem CID | 104854539 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-nitro-4-(4,4,4-trifluorobutan-2-ylamino)benzamide |
| SMILES | CC(CC(F)(F)F)Nc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F3N3O3/c1-6(5-11(12,13)14)16-8-3-2-7(10(15)18)4-9(8)17(19)20/h2-4,6,16H,5H2,1H3,(H2,15,18) |
| InChIKey | HNHKNGCFFSCQSE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|