C22H28N6O8 — CID 138523794
4-[[(2S,3S)-4-(4-carbamoyl-2-nitroanilino)-2,3-diethoxybutyl]amino]-3-nitrobenzamide (PubChem CID 138523794) has the molecular formula C22H28N6O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is 4-[[(2S,3S)-4-(4-carbamoyl-2-nitroanilino)-2,3-diethoxybutyl]amino]-3-nitrobenzamide.
| Compound Name | 4-[[(2S,3S)-4-(4-carbamoyl-2-nitroanilino)-2,3-diethoxybutyl]amino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 138523794 |
| Molecular Formula | C22H28N6O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 4-[[(2S,3S)-4-(4-carbamoyl-2-nitroanilino)-2,3-diethoxybutyl]amino]-3-nitrobenzamide |
| SMILES | CCO[C@@H](CNc1ccc(C(N)=O)cc1[N+](=O)[O-])[C@H](CNc1ccc(C(N)=O)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C22H28N6O8/c1-3-35-19(11-25-15-7-5-13(21(23)29)9-17(15)27(31)32)20(36-4-2)12-26-16-8-6-14(22(24)30)10-18(16)28(33)34/h5-10,19-20,25-26H,3-4,11-12H2,1-2H3,(H2,23,29)(H2,24,30)/t19-,20-/m0/s1 |
| InChIKey | JIVZZWICVZDHSU-PMACEKPBSA-N |
| XLogP | 2.04 |
| TPSA | 214.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|