C30H37N6O9+ — CID 142553898
[5-carbamoyl-2-[[(2S,3S)-4-[4-carbamoyl-2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-2,3-diethoxybutyl]amino]phenyl]-oxoazanium (PubChem CID 142553898) has the molecular formula C30H37N6O9+ and a molecular weight of 625.66 g/mol. Its IUPAC name is [5-carbamoyl-2-[[(2S,3S)-4-[4-carbamoyl-2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-2,3-diethoxybutyl]amino]phenyl]-oxoazanium.
| Compound Name | [5-carbamoyl-2-[[(2S,3S)-4-[4-carbamoyl-2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-2,3-diethoxybutyl]amino]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 142553898 |
| Molecular Formula | C30H37N6O9+ |
| Molecular Weight | 625.66 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | [5-carbamoyl-2-[[(2S,3S)-4-[4-carbamoyl-2-[(4-methoxyphenyl)methoxy]-6-nitroanilino]-2,3-diethoxybutyl]amino]phenyl]-oxoazanium |
| SMILES | CCO[C@@H](CNc1ccc(C(N)=O)cc1[NH+]=O)[C@H](CNc1c(OCc2ccc(OC)cc2)cc(C(N)=O)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C30H36N6O9/c1-4-43-26(15-33-22-11-8-19(29(31)37)12-23(22)35-39)27(44-5-2)16-34-28-24(36(40)41)13-20(30(32)38)14-25(28)45-17-18-6-9-21(42-3)10-7-18/h6-14,26-27,33-34H,4-5,15-17H2,1-3H3,(H2,31,37)(H2,32,38)/p+1/t26-,27-/m0/s1 |
| InChIKey | MPWQELOAVQYFRE-SVBPBHIXSA-O |
| XLogP | 2.19 |
| TPSA | 221.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|