C13H18N2O6 — CID 63628246
4-(2,2-diethoxyethoxy)-3-nitrobenzamide (PubChem CID 63628246) has the molecular formula C13H18N2O6 and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-(2,2-diethoxyethoxy)-3-nitrobenzamide.
| Compound Name | 4-(2,2-diethoxyethoxy)-3-nitrobenzamide |
|---|---|
| PubChem CID | 63628246 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-(2,2-diethoxyethoxy)-3-nitrobenzamide |
| SMILES | CCOC(COc1ccc(C(N)=O)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C13H18N2O6/c1-3-19-12(20-4-2)8-21-11-6-5-9(13(14)16)7-10(11)15(17)18/h5-7,12H,3-4,8H2,1-2H3,(H2,14,16) |
| InChIKey | YWRYCDIETHJIJM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|