About 3-ethyl-4-nitrobenzamide
3-ethyl-4-nitrobenzamide (PubChem CID 67525718) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-ethyl-4-nitrobenzamide.
Molecular Properties
| Compound Name | 3-ethyl-4-nitrobenzamide |
| PubChem CID | 67525718 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 3-ethyl-4-nitrobenzamide |
| SMILES | CCc1cc(C(N)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N2O3/c1-2-6-5-7(9(10)12)3-4-8(6)11(13)14/h3-5H,2H2,1H3,(H2,10,12) |
| InChIKey | RHLFYLJMZXZEME-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-nitrobenzamide?
The IUPAC name of 3-ethyl-4-nitrobenzamide (CID 67525718) is 3-ethyl-4-nitrobenzamide.
What is the SMILES notation for 3-ethyl-4-nitrobenzamide?
The canonical SMILES for 3-ethyl-4-nitrobenzamide is CCc1cc(C(N)=O)ccc1[N+](=O)[O-].
What is the InChIKey of 3-ethyl-4-nitrobenzamide?
The InChIKey is RHLFYLJMZXZEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-2-6-5-7(9(10)12)3-4-8(6)11(13)14/h3-5H,2H2,1H3,(H2,10,12).
What are the key properties of 3-ethyl-4-nitrobenzamide?
3-ethyl-4-nitrobenzamide has a molecular weight of 194.19 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-nitrobenzamide is sourced from PubChem (CID 67525718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).