About chlorobenzene;4-ethyl-3-nitrobenzamide
chlorobenzene;4-ethyl-3-nitrobenzamide (PubChem CID 174709581) has the molecular formula C15H15ClN2O3
and a molecular weight of 306.75 g/mol. Its IUPAC name is chlorobenzene;4-ethyl-3-nitrobenzamide.
Molecular Properties
| Compound Name | chlorobenzene;4-ethyl-3-nitrobenzamide |
| PubChem CID | 174709581 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | chlorobenzene;4-ethyl-3-nitrobenzamide |
| SMILES | CCc1ccc(C(N)=O)cc1[N+](=O)[O-].Clc1ccccc1 |
| InChI | InChI=1S/C9H10N2O3.C6H5Cl/c1-2-6-3-4-7(9(10)12)5-8(6)11(13)14;7-6-4-2-1-3-5-6/h3-5H,2H2,1H3,(H2,10,12);1-5H |
| InChIKey | GCYPOCYCPKLMRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;4-ethyl-3-nitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;4-ethyl-3-nitrobenzamide?
The IUPAC name of chlorobenzene;4-ethyl-3-nitrobenzamide (CID 174709581) is chlorobenzene;4-ethyl-3-nitrobenzamide.
What is the SMILES notation for chlorobenzene;4-ethyl-3-nitrobenzamide?
The canonical SMILES for chlorobenzene;4-ethyl-3-nitrobenzamide is CCc1ccc(C(N)=O)cc1[N+](=O)[O-].Clc1ccccc1.
What is the InChIKey of chlorobenzene;4-ethyl-3-nitrobenzamide?
The InChIKey is GCYPOCYCPKLMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3.C6H5Cl/c1-2-6-3-4-7(9(10)12)5-8(6)11(13)14;7-6-4-2-1-3-5-6/h3-5H,2H2,1H3,(H2,10,12);1-5H.
What are the key properties of chlorobenzene;4-ethyl-3-nitrobenzamide?
chlorobenzene;4-ethyl-3-nitrobenzamide has a molecular weight of 306.75 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;4-ethyl-3-nitrobenzamide is sourced from PubChem (CID 174709581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).