About 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid
4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid (PubChem CID 162263157) has the molecular formula C14H9Cl2N3O7
and a molecular weight of 402.15 g/mol. Its IUPAC name is 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid.
Molecular Properties
| Compound Name | 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid |
| PubChem CID | 162263157 |
| Molecular Formula | C14H9Cl2N3O7 |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid |
| SMILES | NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1.O=C(O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5ClN2O3.C7H4ClNO4/c8-5-2-1-4(7(9)11)3-6(5)10(12)13;8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H2,9,11);1-3H,(H,10,11) |
| InChIKey | ZZNMWKWGYPBLLS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid?
The IUPAC name of 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid (CID 162263157) is 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid.
What is the SMILES notation for 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid?
The canonical SMILES for 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid is NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1.O=C(O)c1ccc(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid?
The InChIKey is ZZNMWKWGYPBLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O3.C7H4ClNO4/c8-5-2-1-4(7(9)11)3-6(5)10(12)13;8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H2,9,11);1-3H,(H,10,11).
What are the key properties of 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid?
4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid has a molecular weight of 402.15 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-nitrobenzamide;4-chloro-3-nitrobenzoic acid is sourced from PubChem (CID 162263157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).