3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid

C15H11ClN2O5 — CID 108745366

IUPAC3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid
SMILESO=C(O)c1cccc(CNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1
InChIInChI=1S/C15H11ClN2O5/c16-12-5-4-10(7-13(12)18(22)23)14(19)17-8-9-2-1-3-11(6-9)15(20)21/h1-7H,8H2,(H,17,19)(H,20,21)
InChIKeyKMLZJZLUNLRJBA-UHFFFAOYSA-N
MW334.72 g/mol
LogP2.88
Rot. Bonds5

About 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid

3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid (PubChem CID 108745366) has the molecular formula C15H11ClN2O5 and a molecular weight of 334.72 g/mol. Its IUPAC name is 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid.

Molecular Properties

Compound Name3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid
PubChem CID108745366
Molecular FormulaC15H11ClN2O5
Molecular Weight334.72 g/mol
Exact Mass334.04
IUPAC Name3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid
SMILESO=C(O)c1cccc(CNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1
InChIInChI=1S/C15H11ClN2O5/c16-12-5-4-10(7-13(12)18(22)23)14(19)17-8-9-2-1-3-11(6-9)15(20)21/h1-7H,8H2,(H,17,19)(H,20,21)
InChIKeyKMLZJZLUNLRJBA-UHFFFAOYSA-N
XLogP2.88
TPSA109.54 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.72
LogP ≤ 52.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid?
The IUPAC name of 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid (CID 108745366) is 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid.
What is the SMILES notation for 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid?
The canonical SMILES for 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid is O=C(O)c1cccc(CNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1.
What is the InChIKey of 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid?
The InChIKey is KMLZJZLUNLRJBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2O5/c16-12-5-4-10(7-13(12)18(22)23)14(19)17-8-9-2-1-3-11(6-9)15(20)21/h1-7H,8H2,(H,17,19)(H,20,21).
What are the key properties of 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid?
3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid has a molecular weight of 334.72 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(4-chloro-3-nitrobenzoyl)amino]methyl]benzoic acid is sourced from PubChem (CID 108745366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).