C17H17N3O5 — CID 108745373
3-[[[4-(dimethylamino)-3-nitrobenzoyl]amino]methyl]benzoic acid (PubChem CID 108745373) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3-[[[4-(dimethylamino)-3-nitrobenzoyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[4-(dimethylamino)-3-nitrobenzoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108745373 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-[[[4-(dimethylamino)-3-nitrobenzoyl]amino]methyl]benzoic acid |
| SMILES | CN(C)c1ccc(C(=O)NCc2cccc(C(=O)O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O5/c1-19(2)14-7-6-12(9-15(14)20(24)25)16(21)18-10-11-4-3-5-13(8-11)17(22)23/h3-9H,10H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | JQDNOYMQGQJHED-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|