About 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid
3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid (PubChem CID 161088478) has the molecular formula C14H9Br2Cl2NO3
and a molecular weight of 469.94 g/mol. Its IUPAC name is 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid.
Molecular Properties
| Compound Name | 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid |
| PubChem CID | 161088478 |
| Molecular Formula | C14H9Br2Cl2NO3 |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 466.83 |
| IUPAC Name | 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid |
| SMILES | NC(=O)c1ccc(Cl)c(Br)c1.O=C(O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C7H5BrClNO.C7H4BrClO2/c2*8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11);1-3H,(H,10,11) |
| InChIKey | UGVRGFMNFGYCHO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid?
The IUPAC name of 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid (CID 161088478) is 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid.
What is the SMILES notation for 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid?
The canonical SMILES for 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid is NC(=O)c1ccc(Cl)c(Br)c1.O=C(O)c1ccc(Cl)c(Br)c1.
What is the InChIKey of 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid?
The InChIKey is UGVRGFMNFGYCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrClNO.C7H4BrClO2/c2*8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H2,10,11);1-3H,(H,10,11).
What are the key properties of 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid?
3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid has a molecular weight of 469.94 g/mol, XLogP of 5.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-chlorobenzamide;3-bromo-4-chlorobenzoic acid is sourced from PubChem (CID 161088478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).