3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid

C13H7BrCl2O2S — CID 82802076

IUPAC3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid
SMILESO=C(O)c1ccc(Sc2ccc(Cl)c(Cl)c2)c(Br)c1
InChIInChI=1S/C13H7BrCl2O2S/c14-9-5-7(13(17)18)1-4-12(9)19-8-2-3-10(15)11(16)6-8/h1-6H,(H,17,18)
InChIKeyAFKJAGPKXLBPRX-UHFFFAOYSA-N
MW378.07 g/mol
LogP5.61
Rot. Bonds3

About 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid

3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid (PubChem CID 82802076) has the molecular formula C13H7BrCl2O2S and a molecular weight of 378.07 g/mol. Its IUPAC name is 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid.

Molecular Properties

Compound Name3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid
PubChem CID82802076
Molecular FormulaC13H7BrCl2O2S
Molecular Weight378.07 g/mol
Exact Mass375.87
IUPAC Name3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid
SMILESO=C(O)c1ccc(Sc2ccc(Cl)c(Cl)c2)c(Br)c1
InChIInChI=1S/C13H7BrCl2O2S/c14-9-5-7(13(17)18)1-4-12(9)19-8-2-3-10(15)11(16)6-8/h1-6H,(H,17,18)
InChIKeyAFKJAGPKXLBPRX-UHFFFAOYSA-N
XLogP5.61
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500378.07
LogP ≤ 55.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid?
The IUPAC name of 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid (CID 82802076) is 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid.
What is the SMILES notation for 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid?
The canonical SMILES for 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid is O=C(O)c1ccc(Sc2ccc(Cl)c(Cl)c2)c(Br)c1.
What is the InChIKey of 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid?
The InChIKey is AFKJAGPKXLBPRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrCl2O2S/c14-9-5-7(13(17)18)1-4-12(9)19-8-2-3-10(15)11(16)6-8/h1-6H,(H,17,18).
What are the key properties of 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid?
3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid has a molecular weight of 378.07 g/mol, XLogP of 5.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(3,4-dichlorophenyl)sulfanylbenzoic acid is sourced from PubChem (CID 82802076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).