4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid

C14H8BrNO2S2 — CID 82800722

IUPAC4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid
SMILESO=C(O)c1ccc(Sc2nc3ccccc3s2)c(Br)c1
InChIInChI=1S/C14H8BrNO2S2/c15-9-7-8(13(17)18)5-6-11(9)19-14-16-10-3-1-2-4-12(10)20-14/h1-7H,(H,17,18)
InChIKeyHWVHQUNAZSWWAA-UHFFFAOYSA-N
MW366.26 g/mol
LogP4.91
Rot. Bonds3

About 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid

4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid (PubChem CID 82800722) has the molecular formula C14H8BrNO2S2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid.

Molecular Properties

Compound Name4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid
PubChem CID82800722
Molecular FormulaC14H8BrNO2S2
Molecular Weight366.26 g/mol
Exact Mass364.92
IUPAC Name4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid
SMILESO=C(O)c1ccc(Sc2nc3ccccc3s2)c(Br)c1
InChIInChI=1S/C14H8BrNO2S2/c15-9-7-8(13(17)18)5-6-11(9)19-14-16-10-3-1-2-4-12(10)20-14/h1-7H,(H,17,18)
InChIKeyHWVHQUNAZSWWAA-UHFFFAOYSA-N
XLogP4.91
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.26
LogP ≤ 54.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid?
The IUPAC name of 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid (CID 82800722) is 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid.
What is the SMILES notation for 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid?
The canonical SMILES for 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid is O=C(O)c1ccc(Sc2nc3ccccc3s2)c(Br)c1.
What is the InChIKey of 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid?
The InChIKey is HWVHQUNAZSWWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrNO2S2/c15-9-7-8(13(17)18)5-6-11(9)19-14-16-10-3-1-2-4-12(10)20-14/h1-7H,(H,17,18).
What are the key properties of 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid?
4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid has a molecular weight of 366.26 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-ylsulfanyl)-3-bromobenzoic acid is sourced from PubChem (CID 82800722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).