C14H10N2O2S2 — CID 115547402
2-amino-3-(1,3-benzothiazol-2-ylsulfanyl)benzoic acid (PubChem CID 115547402) has the molecular formula C14H10N2O2S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-amino-3-(1,3-benzothiazol-2-ylsulfanyl)benzoic acid.
| Compound Name | 2-amino-3-(1,3-benzothiazol-2-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 115547402 |
| Molecular Formula | C14H10N2O2S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-amino-3-(1,3-benzothiazol-2-ylsulfanyl)benzoic acid |
| SMILES | Nc1c(Sc2nc3ccccc3s2)cccc1C(=O)O |
| InChI | InChI=1S/C14H10N2O2S2/c15-12-8(13(17)18)4-3-7-11(12)20-14-16-9-5-1-2-6-10(9)19-14/h1-7H,15H2,(H,17,18) |
| InChIKey | UAWJNNCRMAHEKR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|