2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid

C9H7N3O2S2 — CID 115547475

IUPAC2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid
SMILESNc1c(Sc2nncs2)cccc1C(=O)O
InChIInChI=1S/C9H7N3O2S2/c10-7-5(8(13)14)2-1-3-6(7)16-9-12-11-4-15-9/h1-4H,10H2,(H,13,14)
InChIKeyOEVYQIHKXIMYAP-UHFFFAOYSA-N
MW253.31 g/mol
LogP1.97
Rot. Bonds3

About 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid

2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid (PubChem CID 115547475) has the molecular formula C9H7N3O2S2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid.

Molecular Properties

Compound Name2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid
PubChem CID115547475
Molecular FormulaC9H7N3O2S2
Molecular Weight253.31 g/mol
Exact Mass253.00
IUPAC Name2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid
SMILESNc1c(Sc2nncs2)cccc1C(=O)O
InChIInChI=1S/C9H7N3O2S2/c10-7-5(8(13)14)2-1-3-6(7)16-9-12-11-4-15-9/h1-4H,10H2,(H,13,14)
InChIKeyOEVYQIHKXIMYAP-UHFFFAOYSA-N
XLogP1.97
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.31
LogP ≤ 51.97
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid?
The IUPAC name of 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid (CID 115547475) is 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid.
What is the SMILES notation for 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid?
The canonical SMILES for 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid is Nc1c(Sc2nncs2)cccc1C(=O)O.
What is the InChIKey of 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid?
The InChIKey is OEVYQIHKXIMYAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2S2/c10-7-5(8(13)14)2-1-3-6(7)16-9-12-11-4-15-9/h1-4H,10H2,(H,13,14).
What are the key properties of 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid?
2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid has a molecular weight of 253.31 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(1,3,4-thiadiazol-2-ylsulfanyl)benzoic acid is sourced from PubChem (CID 115547475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).