C10H9N3O2S2 — CID 112580023
methyl 3-amino-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzoate (PubChem CID 112580023) has the molecular formula C10H9N3O2S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl 3-amino-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzoate.
| Compound Name | methyl 3-amino-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzoate |
|---|---|
| PubChem CID | 112580023 |
| Molecular Formula | C10H9N3O2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | methyl 3-amino-2-(1,3,4-thiadiazol-2-ylsulfanyl)benzoate |
| SMILES | COC(=O)c1cccc(N)c1Sc1nncs1 |
| InChI | InChI=1S/C10H9N3O2S2/c1-15-9(14)6-3-2-4-7(11)8(6)17-10-13-12-5-16-10/h2-5H,11H2,1H3 |
| InChIKey | YUOMWDSSEGXXCR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|