C15H12N2O3S — CID 115935922
methyl 3-amino-2-(1,3-benzoxazol-2-ylsulfanyl)benzoate (PubChem CID 115935922) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl 3-amino-2-(1,3-benzoxazol-2-ylsulfanyl)benzoate.
| Compound Name | methyl 3-amino-2-(1,3-benzoxazol-2-ylsulfanyl)benzoate |
|---|---|
| PubChem CID | 115935922 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | methyl 3-amino-2-(1,3-benzoxazol-2-ylsulfanyl)benzoate |
| SMILES | COC(=O)c1cccc(N)c1Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C15H12N2O3S/c1-19-14(18)9-5-4-6-10(16)13(9)21-15-17-11-7-2-3-8-12(11)20-15/h2-8H,16H2,1H3 |
| InChIKey | YZACPDWIZBRRST-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|