C22H15N3O4 — CID 122415158
methyl 2-[2-(2-aminophenyl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate (PubChem CID 122415158) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl 2-[2-(2-aminophenyl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate.
| Compound Name | methyl 2-[2-(2-aminophenyl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 122415158 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | methyl 2-[2-(2-aminophenyl)-1,3-benzoxazol-4-yl]-1,3-benzoxazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2oc(-c3cccc4oc(-c5ccccc5N)nc34)nc12 |
| InChI | InChI=1S/C22H15N3O4/c1-27-22(26)14-8-5-11-17-19(14)25-21(29-17)13-7-4-10-16-18(13)24-20(28-16)12-6-2-3-9-15(12)23/h2-11H,23H2,1H3 |
| InChIKey | UIBFNPLXYOVSHK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|