C30H24N2O5 — CID 89323984
methyl 2-[2-amino-3-[1-(4-benzyl-2-hydroxyphenyl)ethenoxy]phenyl]-1,3-benzoxazole-4-carboxylate (PubChem CID 89323984) has the molecular formula C30H24N2O5 and a molecular weight of 492.53 g/mol. Its IUPAC name is methyl 2-[2-amino-3-[1-(4-benzyl-2-hydroxyphenyl)ethenoxy]phenyl]-1,3-benzoxazole-4-carboxylate.
| Compound Name | methyl 2-[2-amino-3-[1-(4-benzyl-2-hydroxyphenyl)ethenoxy]phenyl]-1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 89323984 |
| Molecular Formula | C30H24N2O5 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | methyl 2-[2-amino-3-[1-(4-benzyl-2-hydroxyphenyl)ethenoxy]phenyl]-1,3-benzoxazole-4-carboxylate |
| SMILES | C=C(Oc1cccc(-c2nc3c(C(=O)OC)cccc3o2)c1N)c1ccc(Cc2ccccc2)cc1O |
| InChI | InChI=1S/C30H24N2O5/c1-18(21-15-14-20(17-24(21)33)16-19-8-4-3-5-9-19)36-25-12-6-10-22(27(25)31)29-32-28-23(30(34)35-2)11-7-13-26(28)37-29/h3-15,17,33H,1,16,31H2,2H3 |
| InChIKey | FXIQHLKWUPWPIT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|