C21H14N2O5 — CID 25158661
2-(2-benzamido-3-hydroxyphenyl)-1,3-benzoxazole-4-carboxylic acid (PubChem CID 25158661) has the molecular formula C21H14N2O5 and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-(2-benzamido-3-hydroxyphenyl)-1,3-benzoxazole-4-carboxylic acid.
| Compound Name | 2-(2-benzamido-3-hydroxyphenyl)-1,3-benzoxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 25158661 |
| Molecular Formula | C21H14N2O5 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-(2-benzamido-3-hydroxyphenyl)-1,3-benzoxazole-4-carboxylic acid |
| SMILES | O=C(Nc1c(O)cccc1-c1nc2c(C(=O)O)cccc2o1)c1ccccc1 |
| InChI | InChI=1S/C21H14N2O5/c24-15-10-4-8-13(17(15)22-19(25)12-6-2-1-3-7-12)20-23-18-14(21(26)27)9-5-11-16(18)28-20/h1-11,24H,(H,22,25)(H,26,27) |
| InChIKey | VBLLBHXPFURJSP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|