C12H5Br2NO3S — CID 114021961
2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazole-4-carboxylic acid (PubChem CID 114021961) has the molecular formula C12H5Br2NO3S and a molecular weight of 403.05 g/mol. Its IUPAC name is 2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazole-4-carboxylic acid.
| Compound Name | 2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114021961 |
| Molecular Formula | C12H5Br2NO3S |
| Molecular Weight | 403.05 g/mol |
| Exact Mass | 400.84 |
| IUPAC Name | 2-(2,5-dibromothiophen-3-yl)-1,3-benzoxazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc2oc(-c3cc(Br)sc3Br)nc12 |
| InChI | InChI=1S/C12H5Br2NO3S/c13-8-4-6(10(14)19-8)11-15-9-5(12(16)17)2-1-3-7(9)18-11/h1-4H,(H,16,17) |
| InChIKey | JURYUOYIYIHUFA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.05 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |