C10H9NO3 — CID 14616762
methyl 2-methyl-1,3-benzoxazole-4-carboxylate (PubChem CID 14616762) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 2-methyl-1,3-benzoxazole-4-carboxylate.
| Compound Name | methyl 2-methyl-1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 14616762 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | methyl 2-methyl-1,3-benzoxazole-4-carboxylate |
| SMILES | COC(=O)c1cccc2oc(C)nc12 |
| InChI | InChI=1S/C10H9NO3/c1-6-11-9-7(10(12)13-2)4-3-5-8(9)14-6/h3-5H,1-2H3 |
| InChIKey | XDEABWGAOREBSR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |