C17H17NO2S — CID 115935930
methyl 3-amino-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoate (PubChem CID 115935930) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is methyl 3-amino-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoate.
| Compound Name | methyl 3-amino-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoate |
|---|---|
| PubChem CID | 115935930 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | methyl 3-amino-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoate |
| SMILES | COC(=O)c1cccc(N)c1Sc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H17NO2S/c1-20-17(19)14-6-3-7-15(18)16(14)21-13-9-8-11-4-2-5-12(11)10-13/h3,6-10H,2,4-5,18H2,1H3 |
| InChIKey | ZVDPQRNPANZVNO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|