C13H16O2S — CID 60730756
methyl 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoate (PubChem CID 60730756) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoate.
| Compound Name | methyl 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 60730756 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoate |
| SMILES | COC(=O)C(C)Sc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H16O2S/c1-9(13(14)15-2)16-12-7-6-10-4-3-5-11(10)8-12/h6-9H,3-5H2,1-2H3 |
| InChIKey | LPKSKBDNUHVWDA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |