C19H20N2O2S — CID 8800471
4-[[(2R)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoyl]amino]benzamide (PubChem CID 8800471) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-[[(2R)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoyl]amino]benzamide.
| Compound Name | 4-[[(2R)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 8800471 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[[(2R)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)propanoyl]amino]benzamide |
| SMILES | C[C@@H](Sc1ccc2c(c1)CCC2)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-12(24-17-10-7-13-3-2-4-15(13)11-17)19(23)21-16-8-5-14(6-9-16)18(20)22/h5-12H,2-4H2,1H3,(H2,20,22)(H,21,23)/t12-/m1/s1 |
| InChIKey | HTOOIHOQPYNWIU-GFCCVEGCSA-N |
| XLogP | 3.39 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |