C20H23NOS — CID 8996376
(2S)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(2-phenylethyl)propanamide (PubChem CID 8996376) has the molecular formula C20H23NOS and a molecular weight of 325.48 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(2-phenylethyl)propanamide.
| Compound Name | (2S)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 8996376 |
| Molecular Formula | C20H23NOS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-N-(2-phenylethyl)propanamide |
| SMILES | C[C@H](Sc1ccc2c(c1)CCC2)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H23NOS/c1-15(20(22)21-13-12-16-6-3-2-4-7-16)23-19-11-10-17-8-5-9-18(17)14-19/h2-4,6-7,10-11,14-15H,5,8-9,12-13H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | XJGAJKAXZUWRTE-HNNXBMFYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |