C17H17F2NOS — CID 24500467
2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylethyl)propanamide (PubChem CID 24500467) has the molecular formula C17H17F2NOS and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylethyl)propanamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 24500467 |
| Molecular Formula | C17H17F2NOS |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-(2-phenylethyl)propanamide |
| SMILES | CC(Sc1ccc(F)c(F)c1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C17H17F2NOS/c1-12(22-14-7-8-15(18)16(19)11-14)17(21)20-10-9-13-5-3-2-4-6-13/h2-8,11-12H,9-10H2,1H3,(H,20,21) |
| InChIKey | BESWVFIILQFMBN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |