C21H22ClN3OS — CID 134027611
N-[2-(1-benzylimidazol-2-yl)ethyl]-2-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 134027611) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is N-[2-(1-benzylimidazol-2-yl)ethyl]-2-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-2-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 134027611 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-2-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)NCCc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-16(27-19-9-7-18(22)8-10-19)21(26)24-12-11-20-23-13-14-25(20)15-17-5-3-2-4-6-17/h2-10,13-14,16H,11-12,15H2,1H3,(H,24,26) |
| InChIKey | UKWMHHDAGOPIQF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |