C19H16ClF2N3O — CID 134039701
N-[2-(1-benzylimidazol-2-yl)ethyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 134039701) has the molecular formula C19H16ClF2N3O and a molecular weight of 375.81 g/mol. Its IUPAC name is N-[2-(1-benzylimidazol-2-yl)ethyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 134039701 |
| Molecular Formula | C19H16ClF2N3O |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[2-(1-benzylimidazol-2-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(NCCc1nccn1Cc1ccccc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H16ClF2N3O/c20-15-11-17(22)16(21)10-14(15)19(26)24-7-6-18-23-8-9-25(18)12-13-4-2-1-3-5-13/h1-5,8-11H,6-7,12H2,(H,24,26) |
| InChIKey | QSHHHYLNCMRTEO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|