C20H22ClF2N3O — CID 39985361
N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 39985361) has the molecular formula C20H22ClF2N3O and a molecular weight of 393.87 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 39985361 |
| Molecular Formula | C20H22ClF2N3O |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(NCCN1CCN(Cc2ccccc2)CC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H22ClF2N3O/c21-17-13-19(23)18(22)12-16(17)20(27)24-6-7-25-8-10-26(11-9-25)14-15-4-2-1-3-5-15/h1-5,12-13H,6-11,14H2,(H,24,27) |
| InChIKey | YQXJWXYJDRLZQZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|