C15H19ClF2N2O2 — CID 46447092
2-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,5-difluorobenzamide (PubChem CID 46447092) has the molecular formula C15H19ClF2N2O2 and a molecular weight of 332.78 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 46447092 |
| Molecular Formula | C15H19ClF2N2O2 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-chloro-N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,5-difluorobenzamide |
| SMILES | CC1CN(CCNC(=O)c2cc(F)c(F)cc2Cl)CC(C)O1 |
| InChI | InChI=1S/C15H19ClF2N2O2/c1-9-7-20(8-10(2)22-9)4-3-19-15(21)11-5-13(17)14(18)6-12(11)16/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,19,21) |
| InChIKey | ZDTQGTWMVZHYAG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|