C16H23N3O4S — CID 55527475
N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-5-methylsulfanyl-2-nitrobenzamide (PubChem CID 55527475) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-5-methylsulfanyl-2-nitrobenzamide.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-5-methylsulfanyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 55527475 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-5-methylsulfanyl-2-nitrobenzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NCCN2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C16H23N3O4S/c1-11-9-18(10-12(2)23-11)7-6-17-16(20)14-8-13(24-3)4-5-15(14)19(21)22/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H,17,20) |
| InChIKey | CTXNZZORVMRFSM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|