C19H29N3O3S — CID 60569339
N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-5-methylsulfanyl-2-nitrobenzamide (PubChem CID 60569339) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-5-methylsulfanyl-2-nitrobenzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-5-methylsulfanyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 60569339 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-5-methylsulfanyl-2-nitrobenzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NCC(C)(C)N2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C19H29N3O3S/c1-13-8-14(2)11-21(10-13)19(3,4)12-20-18(23)16-9-15(26-5)6-7-17(16)22(24)25/h6-7,9,13-14H,8,10-12H2,1-5H3,(H,20,23) |
| InChIKey | VFINWUBNZFRPDZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|