C21H25Cl2N3O — CID 39302925
N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 39302925) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 39302925 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)NCCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H25Cl2N3O/c22-19-7-6-18(14-20(19)23)15-21(27)24-8-9-25-10-12-26(13-11-25)16-17-4-2-1-3-5-17/h1-7,14H,8-13,15-16H2,(H,24,27) |
| InChIKey | RHGKZASRQFESRH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |