C16H22N2OS2 — CID 51235045
[1-oxo-1-(2-phenylethylamino)propan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 51235045) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylethylamino)propan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [1-oxo-1-(2-phenylethylamino)propan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 51235045 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [1-oxo-1-(2-phenylethylamino)propan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | CC(SC(=S)N1CCCC1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C16H22N2OS2/c1-13(21-16(20)18-11-5-6-12-18)15(19)17-10-9-14-7-3-2-4-8-14/h2-4,7-8,13H,5-6,9-12H2,1H3,(H,17,19) |
| InChIKey | SCDSTMBIXWRBII-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|