C15H19ClN2OS2 — CID 9494444
[(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 9494444) has the molecular formula C15H19ClN2OS2 and a molecular weight of 342.92 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 9494444 |
| Molecular Formula | C15H19ClN2OS2 |
| Molecular Weight | 342.92 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](C)SC(=S)N1CCCC1 |
| InChI | InChI=1S/C15H19ClN2OS2/c1-10-5-6-12(16)9-13(10)17-14(19)11(2)21-15(20)18-7-3-4-8-18/h5-6,9,11H,3-4,7-8H2,1-2H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | KZCNOFXDCBWOTF-LLVKDONJSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|