C13H15Cl2N3OS2 — CID 7606283
[(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 7606283) has the molecular formula C13H15Cl2N3OS2 and a molecular weight of 364.32 g/mol. Its IUPAC name is [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7606283 |
| Molecular Formula | C13H15Cl2N3OS2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@H](SC(=S)N1CCCC1)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N3OS2/c1-8(21-13(20)18-4-2-3-5-18)12(19)17-11-10(15)6-9(14)7-16-11/h6-8H,2-5H2,1H3,(H,16,17,19)/t8-/m0/s1 |
| InChIKey | APSCLZFOHGHCTE-QMMMGPOBSA-N |
| XLogP | 3.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|