C15H18N4O2S2 — CID 8539528
[(2R)-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 8539528) has the molecular formula C15H18N4O2S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2R)-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8539528 |
| Molecular Formula | C15H18N4O2S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(2R)-1-oxo-1-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)amino]propan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | C[C@@H](SC(=S)N1CCCC1)C(=O)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C15H18N4O2S2/c1-9(23-15(22)19-6-2-3-7-19)13(20)16-10-4-5-11-12(8-10)18-14(21)17-11/h4-5,8-9H,2-3,6-7H2,1H3,(H,16,20)(H2,17,18,21)/t9-/m1/s1 |
| InChIKey | VSVTVZRFVLRSEK-SECBINFHSA-N |
| XLogP | 2.30 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|