C16H22N2OS2 — CID 8539310
[(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 8539310) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8539310 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](C)SC(=S)N2CCCC2)c1 |
| InChI | InChI=1S/C16H22N2OS2/c1-11-6-7-12(2)14(10-11)17-15(19)13(3)21-16(20)18-8-4-5-9-18/h6-7,10,13H,4-5,8-9H2,1-3H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | MGIFKFJJTYPMSC-ZDUSSCGKSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|