C21H24N2O2S2 — CID 7915765
[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate (PubChem CID 7915765) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7915765 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](SC(=S)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-15-10-11-18(25-2)17(14-15)22-20(24)19(16-8-4-3-5-9-16)27-21(26)23-12-6-7-13-23/h3-5,8-11,14,19H,6-7,12-13H2,1-2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | WUMURNIEPIKDPS-IBGZPJMESA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|