C21H24N2OS2 — CID 42972853
[2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate (PubChem CID 42972853) has the molecular formula C21H24N2OS2 and a molecular weight of 384.57 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 42972853 |
| Molecular Formula | C21H24N2OS2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxo-1-phenylethyl] pyrrolidine-1-carbodithioate |
| SMILES | Cc1ccc(C)c(NC(=O)C(SC(=S)N2CCCC2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2OS2/c1-15-10-11-16(2)18(14-15)22-20(24)19(17-8-4-3-5-9-17)26-21(25)23-12-6-7-13-23/h3-5,8-11,14,19H,6-7,12-13H2,1-2H3,(H,22,24) |
| InChIKey | IAJABNODKYDRFR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|