C23H29N3OS — CID 9423360
[2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate (PubChem CID 9423360) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate |
|---|---|
| PubChem CID | 9423360 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate |
| SMILES | Cc1ccc(C)c(NC(=O)CS/C(=N\c2ccccc2)N2CCCCCC2)c1 |
| InChI | InChI=1S/C23H29N3OS/c1-18-12-13-19(2)21(16-18)25-22(27)17-28-23(24-20-10-6-5-7-11-20)26-14-8-3-4-9-15-26/h5-7,10-13,16H,3-4,8-9,14-15,17H2,1-2H3,(H,25,27)/b24-23- |
| InChIKey | ZLHUQRSAQHNYRG-VHXPQNKSSA-N |
| XLogP | 5.54 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|