C21H25N3O2S — CID 9423355
[2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylmorpholine-4-carboximidothioate (PubChem CID 9423355) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is [2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylmorpholine-4-carboximidothioate.
| Compound Name | [2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylmorpholine-4-carboximidothioate |
|---|---|
| PubChem CID | 9423355 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-(2,5-dimethylanilino)-2-oxoethyl] N-phenylmorpholine-4-carboximidothioate |
| SMILES | Cc1ccc(C)c(NC(=O)CS/C(=N/c2ccccc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-16-8-9-17(2)19(14-16)23-20(25)15-27-21(24-10-12-26-13-11-24)22-18-6-4-3-5-7-18/h3-9,14H,10-13,15H2,1-2H3,(H,23,25)/b22-21+ |
| InChIKey | FRBUPRXOQPLBLB-QURGRASLSA-N |
| XLogP | 4.00 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|