C25H27N3OS — CID 9458349
[2-(naphthalen-1-ylamino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate (PubChem CID 9458349) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate |
|---|---|
| PubChem CID | 9458349 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] N-phenylazepane-1-carboximidothioate |
| SMILES | O=C(CS/C(=N/c1ccccc1)N1CCCCCC1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C25H27N3OS/c29-24(27-23-16-10-12-20-11-6-7-15-22(20)23)19-30-25(26-21-13-4-3-5-14-21)28-17-8-1-2-9-18-28/h3-7,10-16H,1-2,8-9,17-19H2,(H,27,29)/b26-25+ |
| InChIKey | YYEDPGUXVMGQGW-OCEACIFDSA-N |
| XLogP | 6.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|