C20H22FN3OS — CID 9423322
[2-(4-fluoroanilino)-2-oxoethyl] N-phenylpiperidine-1-carboximidothioate (PubChem CID 9423322) has the molecular formula C20H22FN3OS and a molecular weight of 371.48 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] N-phenylpiperidine-1-carboximidothioate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] N-phenylpiperidine-1-carboximidothioate |
|---|---|
| PubChem CID | 9423322 |
| Molecular Formula | C20H22FN3OS |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] N-phenylpiperidine-1-carboximidothioate |
| SMILES | O=C(CS/C(=N/c1ccccc1)N1CCCCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FN3OS/c21-16-9-11-18(12-10-16)22-19(25)15-26-20(24-13-5-2-6-14-24)23-17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-15H2,(H,22,25)/b23-20+ |
| InChIKey | GQEYFVZBBSYMQB-BSYVCWPDSA-N |
| XLogP | 4.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|