C22H27N4O2S+ — CID 9423205
[2-(4-acetylanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate (PubChem CID 9423205) has the molecular formula C22H27N4O2S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate |
|---|---|
| PubChem CID | 9423205 |
| Molecular Formula | C22H27N4O2S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazin-4-ium-1-carboximidothioate |
| SMILES | CC(=O)c1ccc(NC(=O)CS/C(=N\c2ccccc2)N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O2S/c1-17(27)18-8-10-20(11-9-18)23-21(28)16-29-22(24-19-6-4-3-5-7-19)26-14-12-25(2)13-15-26/h3-11H,12-16H2,1-2H3,(H,23,28)/p+1/b24-22- |
| InChIKey | DHKVFSZVWFWNOG-GYHWCHFESA-O |
| XLogP | 2.08 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|