C22H28N4O2S — CID 9423716
[2-(4-ethoxyanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazine-1-carboximidothioate (PubChem CID 9423716) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazine-1-carboximidothioate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazine-1-carboximidothioate |
|---|---|
| PubChem CID | 9423716 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 4-methyl-N-phenylpiperazine-1-carboximidothioate |
| SMILES | CCOc1ccc(NC(=O)CS/C(=N/c2ccccc2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-28-20-11-9-19(10-12-20)23-21(27)17-29-22(24-18-7-5-4-6-8-18)26-15-13-25(2)14-16-26/h4-12H,3,13-17H2,1-2H3,(H,23,27)/b24-22+ |
| InChIKey | GBCPRAGQYCAWIY-ZNTNEXAZSA-N |
| XLogP | 3.69 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|