C22H27N3O2S — CID 9456659
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] N-phenylmorpholine-4-carboximidothioate (PubChem CID 9456659) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] N-phenylmorpholine-4-carboximidothioate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] N-phenylmorpholine-4-carboximidothioate |
|---|---|
| PubChem CID | 9456659 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] N-phenylmorpholine-4-carboximidothioate |
| SMILES | Cc1cc(C)c(NC(=O)CS/C(=N/c2ccccc2)N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C22H27N3O2S/c1-16-13-17(2)21(18(3)14-16)24-20(26)15-28-22(25-9-11-27-12-10-25)23-19-7-5-4-6-8-19/h4-8,13-14H,9-12,15H2,1-3H3,(H,24,26)/b23-22+ |
| InChIKey | HHQWLFNXAJQNHC-GHVJWSGMSA-N |
| XLogP | 4.30 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|