C18H19NO3S — CID 4907237
2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanylbenzoic acid (PubChem CID 4907237) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 4907237 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanylbenzoic acid |
| SMILES | Cc1cc(C)c(NC(=O)CSc2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C18H19NO3S/c1-11-8-12(2)17(13(3)9-11)19-16(20)10-23-15-7-5-4-6-14(15)18(21)22/h4-9H,10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | LXOKGYDBYATRAC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |